C10H19N3O4 — CID 57067480
[(2S)-2,4-diamino-4-oxobutanoyl] (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 57067480) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is [(2S)-2,4-diamino-4-oxobutanoyl] (2S,3S)-2-amino-3-methylpentanoate.
| Compound Name | [(2S)-2,4-diamino-4-oxobutanoyl] (2S,3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 57067480 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(2S)-2,4-diamino-4-oxobutanoyl] (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OC(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C10H19N3O4/c1-3-5(2)8(13)10(16)17-9(15)6(11)4-7(12)14/h5-6,8H,3-4,11,13H2,1-2H3,(H2,12,14)/t5-,6-,8-/m0/s1 |
| InChIKey | IWYMBENONFPDLO-HAFWLYHUSA-N |
| XLogP | -1.37 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|