C17H35N5O10 — CID 87528441
(2S,3R)-2-amino-3-hydroxybutanoic acid;[(2S,3R)-2-amino-3-hydroxybutanoyl] (2S)-2,4-diamino-4-oxobutanoate;(2S)-2-amino-3-methylbutanoic acid (PubChem CID 87528441) has the molecular formula C17H35N5O10 and a molecular weight of 469.49 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxybutanoic acid;[(2S,3R)-2-amino-3-hydroxybutanoyl] (2S)-2,4-diamino-4-oxobutanoate;(2S)-2-amino-3-methylbutanoic acid.
| Compound Name | (2S,3R)-2-amino-3-hydroxybutanoic acid;[(2S,3R)-2-amino-3-hydroxybutanoyl] (2S)-2,4-diamino-4-oxobutanoate;(2S)-2-amino-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87528441 |
| Molecular Formula | C17H35N5O10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxybutanoic acid;[(2S,3R)-2-amino-3-hydroxybutanoyl] (2S)-2,4-diamino-4-oxobutanoate;(2S)-2-amino-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.C[C@@H](O)[C@H](N)C(=O)O.C[C@@H](O)[C@H](N)C(=O)OC(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C8H15N3O5.C5H11NO2.C4H9NO3/c1-3(12)6(11)8(15)16-7(14)4(9)2-5(10)13;1-3(2)4(6)5(7)8;1-2(6)3(5)4(7)8/h3-4,6,12H,2,9,11H2,1H3,(H2,10,13);3-4H,6H2,1-2H3,(H,7,8);2-3,6H,5H2,1H3,(H,7,8)/t3-,4+,6+;4-;2-,3+/m101/s1 |
| InChIKey | ZDUYJNXIWYUSLD-CIVWCOSGSA-N |
| XLogP | -4.20 |
| TPSA | 305.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|