C10H21N3O7 — CID 87194814
(2S)-2-amino-3-hydroxypropanoic acid;[(2S)-2-aminopropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate (PubChem CID 87194814) has the molecular formula C10H21N3O7 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;[(2S)-2-aminopropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;[(2S)-2-aminopropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate |
|---|---|
| PubChem CID | 87194814 |
| Molecular Formula | C10H21N3O7 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;[(2S)-2-aminopropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate |
| SMILES | C[C@H](N)C(=O)OC(=O)[C@@H](N)[C@@H](C)O.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H14N2O4.C3H7NO3/c1-3(8)6(11)13-7(12)5(9)4(2)10;4-2(1-5)3(6)7/h3-5,10H,8-9H2,1-2H3;2,5H,1,4H2,(H,6,7)/t3-,4+,5-;2-/m00/s1 |
| InChIKey | FPUIMOXCCRDDIL-PSVOPEBOSA-N |
| XLogP | -3.50 |
| TPSA | 199.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|