C10H19N3O6 — CID 57045399
[(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate (PubChem CID 57045399) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is [(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate.
| Compound Name | [(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate |
|---|---|
| PubChem CID | 57045399 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(2S)-2-amino-3-[(2S)-2-aminopropanoyl]oxypropanoyl] (2S,3R)-2-amino-3-hydroxybutanoate |
| SMILES | C[C@H](N)C(=O)OC[C@H](N)C(=O)OC(=O)[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C10H19N3O6/c1-4(11)8(15)18-3-6(12)9(16)19-10(17)7(13)5(2)14/h4-7,14H,3,11-13H2,1-2H3/t4-,5+,6-,7-/m0/s1 |
| InChIKey | VTLNGURIRRJKCP-VZFHVOOUSA-N |
| XLogP | -3.02 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|