About 2-methoxyethyl 2-amino-3-hydroxybutanoate
2-methoxyethyl 2-amino-3-hydroxybutanoate (PubChem CID 61279925) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-methoxyethyl 2-amino-3-hydroxybutanoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 2-amino-3-hydroxybutanoate |
| PubChem CID | 61279925 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-methoxyethyl 2-amino-3-hydroxybutanoate |
| SMILES | COCCOC(=O)C(N)C(C)O |
| InChI | InChI=1S/C7H15NO4/c1-5(9)6(8)7(10)12-4-3-11-2/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | DNYPPQZZRIZRJF-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 2-amino-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 2-amino-3-hydroxybutanoate?
The IUPAC name of 2-methoxyethyl 2-amino-3-hydroxybutanoate (CID 61279925) is 2-methoxyethyl 2-amino-3-hydroxybutanoate.
What is the SMILES notation for 2-methoxyethyl 2-amino-3-hydroxybutanoate?
The canonical SMILES for 2-methoxyethyl 2-amino-3-hydroxybutanoate is COCCOC(=O)C(N)C(C)O.
What is the InChIKey of 2-methoxyethyl 2-amino-3-hydroxybutanoate?
The InChIKey is DNYPPQZZRIZRJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO4/c1-5(9)6(8)7(10)12-4-3-11-2/h5-6,9H,3-4,8H2,1-2H3.
What are the key properties of 2-methoxyethyl 2-amino-3-hydroxybutanoate?
2-methoxyethyl 2-amino-3-hydroxybutanoate has a molecular weight of 177.20 g/mol, XLogP of -1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-amino-3-hydroxybutanoate is sourced from PubChem (CID 61279925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).