C15H31NO3 — CID 155606011
(3-tert-butyl-4,4-dimethylpentyl) 2-amino-3-hydroxybutanoate (PubChem CID 155606011) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (3-tert-butyl-4,4-dimethylpentyl) 2-amino-3-hydroxybutanoate.
| Compound Name | (3-tert-butyl-4,4-dimethylpentyl) 2-amino-3-hydroxybutanoate |
|---|---|
| PubChem CID | 155606011 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | (3-tert-butyl-4,4-dimethylpentyl) 2-amino-3-hydroxybutanoate |
| SMILES | CC(O)C(N)C(=O)OCCC(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31NO3/c1-10(17)12(16)13(18)19-9-8-11(14(2,3)4)15(5,6)7/h10-12,17H,8-9,16H2,1-7H3 |
| InChIKey | MYCPLDLVOJKRGS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |