About propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride
propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride (PubChem CID 122539225) has the molecular formula C7H16ClNO3
and a molecular weight of 197.66 g/mol. Its IUPAC name is propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride.
Analyze propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride?
The IUPAC name of propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride (CID 122539225) is propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride.
What is the SMILES notation for propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride?
The canonical SMILES for propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride is CC(C)OC(=O)[C@H](N)[C@@H](C)O.Cl.
What is the InChIKey of propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride?
The InChIKey is WTNKLHOYNYGZOQ-KGZKBUQUSA-N. The full InChI is InChI=1S/C7H15NO3.ClH/c1-4(2)11-7(10)6(8)5(3)9;/h4-6,9H,8H2,1-3H3;1H/t5-,6-;/m1./s1.
What are the key properties of propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride?
propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride has a molecular weight of 197.66 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R,3R)-2-amino-3-hydroxybutanoate;hydrochloride is sourced from PubChem (CID 122539225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).