About dipropan-2-yl 2-aminopropanedioate
dipropan-2-yl 2-aminopropanedioate (PubChem CID 141226348) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is dipropan-2-yl 2-aminopropanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl 2-aminopropanedioate |
| PubChem CID | 141226348 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | dipropan-2-yl 2-aminopropanedioate |
| SMILES | CC(C)OC(=O)C(N)C(=O)OC(C)C |
| InChI | InChI=1S/C9H17NO4/c1-5(2)13-8(11)7(10)9(12)14-6(3)4/h5-7H,10H2,1-4H3 |
| InChIKey | HLBKWYIHPJAJCK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 2-aminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 2-aminopropanedioate?
The IUPAC name of dipropan-2-yl 2-aminopropanedioate (CID 141226348) is dipropan-2-yl 2-aminopropanedioate.
What is the SMILES notation for dipropan-2-yl 2-aminopropanedioate?
The canonical SMILES for dipropan-2-yl 2-aminopropanedioate is CC(C)OC(=O)C(N)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl 2-aminopropanedioate?
The InChIKey is HLBKWYIHPJAJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-5(2)13-8(11)7(10)9(12)14-6(3)4/h5-7H,10H2,1-4H3.
What are the key properties of dipropan-2-yl 2-aminopropanedioate?
dipropan-2-yl 2-aminopropanedioate has a molecular weight of 203.24 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 2-aminopropanedioate is sourced from PubChem (CID 141226348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).