About propan-2-amine;propan-2-yl hydrogen carbonate
propan-2-amine;propan-2-yl hydrogen carbonate (PubChem CID 173023636) has the molecular formula C7H17NO3
and a molecular weight of 163.22 g/mol. Its IUPAC name is propan-2-amine;propan-2-yl hydrogen carbonate.
Molecular Properties
| Compound Name | propan-2-amine;propan-2-yl hydrogen carbonate |
| PubChem CID | 173023636 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | propan-2-amine;propan-2-yl hydrogen carbonate |
| SMILES | CC(C)N.CC(C)OC(=O)O |
| InChI | InChI=1S/C4H8O3.C3H9N/c1-3(2)7-4(5)6;1-3(2)4/h3H,1-2H3,(H,5,6);3H,4H2,1-2H3 |
| InChIKey | TZRORHHMAGATLL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-amine;propan-2-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;propan-2-yl hydrogen carbonate?
The IUPAC name of propan-2-amine;propan-2-yl hydrogen carbonate (CID 173023636) is propan-2-amine;propan-2-yl hydrogen carbonate.
What is the SMILES notation for propan-2-amine;propan-2-yl hydrogen carbonate?
The canonical SMILES for propan-2-amine;propan-2-yl hydrogen carbonate is CC(C)N.CC(C)OC(=O)O.
What is the InChIKey of propan-2-amine;propan-2-yl hydrogen carbonate?
The InChIKey is TZRORHHMAGATLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C3H9N/c1-3(2)7-4(5)6;1-3(2)4/h3H,1-2H3,(H,5,6);3H,4H2,1-2H3.
What are the key properties of propan-2-amine;propan-2-yl hydrogen carbonate?
propan-2-amine;propan-2-yl hydrogen carbonate has a molecular weight of 163.22 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;propan-2-yl hydrogen carbonate is sourced from PubChem (CID 173023636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).