About silver;propan-2-amine;propan-2-yl carbamate
silver;propan-2-amine;propan-2-yl carbamate (PubChem CID 172719608) has the molecular formula C7H18AgN2O2+
and a molecular weight of 270.10 g/mol. Its IUPAC name is silver;propan-2-amine;propan-2-yl carbamate.
Molecular Properties
| Compound Name | silver;propan-2-amine;propan-2-yl carbamate |
| PubChem CID | 172719608 |
| Molecular Formula | C7H18AgN2O2+ |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | silver;propan-2-amine;propan-2-yl carbamate |
| SMILES | CC(C)N.CC(C)OC(N)=O.[Ag+] |
| InChI | InChI=1S/C4H9NO2.C3H9N.Ag/c1-3(2)7-4(5)6;1-3(2)4;/h3H,1-2H3,(H2,5,6);3H,4H2,1-2H3;/q;;+1 |
| InChIKey | GIEXXNJMNYTWSZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze silver;propan-2-amine;propan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;propan-2-amine;propan-2-yl carbamate?
The IUPAC name of silver;propan-2-amine;propan-2-yl carbamate (CID 172719608) is silver;propan-2-amine;propan-2-yl carbamate.
What is the SMILES notation for silver;propan-2-amine;propan-2-yl carbamate?
The canonical SMILES for silver;propan-2-amine;propan-2-yl carbamate is CC(C)N.CC(C)OC(N)=O.[Ag+].
What is the InChIKey of silver;propan-2-amine;propan-2-yl carbamate?
The InChIKey is GIEXXNJMNYTWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.C3H9N.Ag/c1-3(2)7-4(5)6;1-3(2)4;/h3H,1-2H3,(H2,5,6);3H,4H2,1-2H3;/q;;+1.
What are the key properties of silver;propan-2-amine;propan-2-yl carbamate?
silver;propan-2-amine;propan-2-yl carbamate has a molecular weight of 270.10 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver;propan-2-amine;propan-2-yl carbamate is sourced from PubChem (CID 172719608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).