About azane;propan-2-yl carbamate
azane;propan-2-yl carbamate (PubChem CID 172769477) has the molecular formula C4H12N2O2
and a molecular weight of 120.15 g/mol. Its IUPAC name is azane;propan-2-yl carbamate.
Molecular Properties
| Compound Name | azane;propan-2-yl carbamate |
| PubChem CID | 172769477 |
| Molecular Formula | C4H12N2O2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | azane;propan-2-yl carbamate |
| SMILES | CC(C)OC(N)=O.N |
| InChI | InChI=1S/C4H9NO2.H3N/c1-3(2)7-4(5)6;/h3H,1-2H3,(H2,5,6);1H3 |
| InChIKey | MTJLFDYEWHNWHL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;propan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propan-2-yl carbamate?
The IUPAC name of azane;propan-2-yl carbamate (CID 172769477) is azane;propan-2-yl carbamate.
What is the SMILES notation for azane;propan-2-yl carbamate?
The canonical SMILES for azane;propan-2-yl carbamate is CC(C)OC(N)=O.N.
What is the InChIKey of azane;propan-2-yl carbamate?
The InChIKey is MTJLFDYEWHNWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.H3N/c1-3(2)7-4(5)6;/h3H,1-2H3,(H2,5,6);1H3.
What are the key properties of azane;propan-2-yl carbamate?
azane;propan-2-yl carbamate has a molecular weight of 120.15 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propan-2-yl carbamate is sourced from PubChem (CID 172769477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).