About propan-2-yl (2S)-2-aminopropanoate
propan-2-yl (2S)-2-aminopropanoate (PubChem CID 13089460) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is propan-2-yl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | propan-2-yl (2S)-2-aminopropanoate |
| PubChem CID | 13089460 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | propan-2-yl (2S)-2-aminopropanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C6H13NO2/c1-4(2)9-6(8)5(3)7/h4-5H,7H2,1-3H3/t5-/m0/s1 |
| InChIKey | QDQVXVRZVCTVHE-YFKPBYRVSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-2-aminopropanoate?
The IUPAC name of propan-2-yl (2S)-2-aminopropanoate (CID 13089460) is propan-2-yl (2S)-2-aminopropanoate.
What is the SMILES notation for propan-2-yl (2S)-2-aminopropanoate?
The canonical SMILES for propan-2-yl (2S)-2-aminopropanoate is CC(C)OC(=O)[C@H](C)N.
What is the InChIKey of propan-2-yl (2S)-2-aminopropanoate?
The InChIKey is QDQVXVRZVCTVHE-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H13NO2/c1-4(2)9-6(8)5(3)7/h4-5H,7H2,1-3H3/t5-/m0/s1.
What are the key properties of propan-2-yl (2S)-2-aminopropanoate?
propan-2-yl (2S)-2-aminopropanoate has a molecular weight of 131.17 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-2-aminopropanoate is sourced from PubChem (CID 13089460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).