About hydron;propan-2-yl (2S)-2-aminopropanoate;chloride
hydron;propan-2-yl (2S)-2-aminopropanoate;chloride (PubChem CID 173116569) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is hydron;propan-2-yl (2S)-2-aminopropanoate;chloride.
Molecular Properties
| Compound Name | hydron;propan-2-yl (2S)-2-aminopropanoate;chloride |
| PubChem CID | 173116569 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | hydron;propan-2-yl (2S)-2-aminopropanoate;chloride |
| SMILES | CC(C)OC(=O)[C@H](C)N.[Cl-].[H+] |
| InChI | InChI=1S/C6H13NO2.ClH/c1-4(2)9-6(8)5(3)7;/h4-5H,7H2,1-3H3;1H/t5-;/m0./s1 |
| InChIKey | YAQKNCSWDMGPOY-JEDNCBNOSA-N |
| XLogP | -2.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;propan-2-yl (2S)-2-aminopropanoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;propan-2-yl (2S)-2-aminopropanoate;chloride?
The IUPAC name of hydron;propan-2-yl (2S)-2-aminopropanoate;chloride (CID 173116569) is hydron;propan-2-yl (2S)-2-aminopropanoate;chloride.
What is the SMILES notation for hydron;propan-2-yl (2S)-2-aminopropanoate;chloride?
The canonical SMILES for hydron;propan-2-yl (2S)-2-aminopropanoate;chloride is CC(C)OC(=O)[C@H](C)N.[Cl-].[H+].
What is the InChIKey of hydron;propan-2-yl (2S)-2-aminopropanoate;chloride?
The InChIKey is YAQKNCSWDMGPOY-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H13NO2.ClH/c1-4(2)9-6(8)5(3)7;/h4-5H,7H2,1-3H3;1H/t5-;/m0./s1.
What are the key properties of hydron;propan-2-yl (2S)-2-aminopropanoate;chloride?
hydron;propan-2-yl (2S)-2-aminopropanoate;chloride has a molecular weight of 167.64 g/mol, XLogP of -2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;propan-2-yl (2S)-2-aminopropanoate;chloride is sourced from PubChem (CID 173116569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).