About 3-methoxybutan-2-yl carbamate
3-methoxybutan-2-yl carbamate (PubChem CID 88788189) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is 3-methoxybutan-2-yl carbamate.
Molecular Properties
| Compound Name | 3-methoxybutan-2-yl carbamate |
| PubChem CID | 88788189 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 3-methoxybutan-2-yl carbamate |
| SMILES | COC(C)C(C)OC(N)=O |
| InChI | InChI=1S/C6H13NO3/c1-4(9-3)5(2)10-6(7)8/h4-5H,1-3H3,(H2,7,8) |
| InChIKey | RDRXFJTUGFIOGH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxybutan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutan-2-yl carbamate?
The IUPAC name of 3-methoxybutan-2-yl carbamate (CID 88788189) is 3-methoxybutan-2-yl carbamate.
What is the SMILES notation for 3-methoxybutan-2-yl carbamate?
The canonical SMILES for 3-methoxybutan-2-yl carbamate is COC(C)C(C)OC(N)=O.
What is the InChIKey of 3-methoxybutan-2-yl carbamate?
The InChIKey is RDRXFJTUGFIOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-4(9-3)5(2)10-6(7)8/h4-5H,1-3H3,(H2,7,8).
What are the key properties of 3-methoxybutan-2-yl carbamate?
3-methoxybutan-2-yl carbamate has a molecular weight of 147.17 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutan-2-yl carbamate is sourced from PubChem (CID 88788189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).