About [2-(methylamino)acetyl] (2S)-2-methylbutanoate
[2-(methylamino)acetyl] (2S)-2-methylbutanoate (PubChem CID 175881617) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is [2-(methylamino)acetyl] (2S)-2-methylbutanoate.
Molecular Properties
| Compound Name | [2-(methylamino)acetyl] (2S)-2-methylbutanoate |
| PubChem CID | 175881617 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | [2-(methylamino)acetyl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OC(=O)CNC |
| InChI | InChI=1S/C8H15NO3/c1-4-6(2)8(11)12-7(10)5-9-3/h6,9H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | YABGLWNDLHSBKT-LURJTMIESA-N |
| XLogP | 0.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)acetyl] (2S)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)acetyl] (2S)-2-methylbutanoate?
The IUPAC name of [2-(methylamino)acetyl] (2S)-2-methylbutanoate (CID 175881617) is [2-(methylamino)acetyl] (2S)-2-methylbutanoate.
What is the SMILES notation for [2-(methylamino)acetyl] (2S)-2-methylbutanoate?
The canonical SMILES for [2-(methylamino)acetyl] (2S)-2-methylbutanoate is CC[C@H](C)C(=O)OC(=O)CNC.
What is the InChIKey of [2-(methylamino)acetyl] (2S)-2-methylbutanoate?
The InChIKey is YABGLWNDLHSBKT-LURJTMIESA-N. The full InChI is InChI=1S/C8H15NO3/c1-4-6(2)8(11)12-7(10)5-9-3/h6,9H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of [2-(methylamino)acetyl] (2S)-2-methylbutanoate?
[2-(methylamino)acetyl] (2S)-2-methylbutanoate has a molecular weight of 173.21 g/mol, XLogP of 0.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)acetyl] (2S)-2-methylbutanoate is sourced from PubChem (CID 175881617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).