About ethyl 2-bromo-2-hydroxyacetate
ethyl 2-bromo-2-hydroxyacetate (PubChem CID 57173380) has the molecular formula C4H7BrO3
and a molecular weight of 183.00 g/mol. Its IUPAC name is ethyl 2-bromo-2-hydroxyacetate.
Molecular Properties
| Compound Name | ethyl 2-bromo-2-hydroxyacetate |
| PubChem CID | 57173380 |
| Molecular Formula | C4H7BrO3 |
| Molecular Weight | 183.00 g/mol |
| Exact Mass | 181.96 |
| IUPAC Name | ethyl 2-bromo-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)Br |
| InChI | InChI=1S/C4H7BrO3/c1-2-8-4(7)3(5)6/h3,6H,2H2,1H3 |
| InChIKey | KFDIXWYADAPEMC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.00 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromo-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-2-hydroxyacetate?
The IUPAC name of ethyl 2-bromo-2-hydroxyacetate (CID 57173380) is ethyl 2-bromo-2-hydroxyacetate.
What is the SMILES notation for ethyl 2-bromo-2-hydroxyacetate?
The canonical SMILES for ethyl 2-bromo-2-hydroxyacetate is CCOC(=O)C(O)Br.
What is the InChIKey of ethyl 2-bromo-2-hydroxyacetate?
The InChIKey is KFDIXWYADAPEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BrO3/c1-2-8-4(7)3(5)6/h3,6H,2H2,1H3.
What are the key properties of ethyl 2-bromo-2-hydroxyacetate?
ethyl 2-bromo-2-hydroxyacetate has a molecular weight of 183.00 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-2-hydroxyacetate is sourced from PubChem (CID 57173380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).