About ethyl 2-amino-2-hydroxyacetate;hydrochloride
ethyl 2-amino-2-hydroxyacetate;hydrochloride (PubChem CID 88745536) has the molecular formula C4H10ClNO3
and a molecular weight of 155.58 g/mol. Its IUPAC name is ethyl 2-amino-2-hydroxyacetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-amino-2-hydroxyacetate;hydrochloride |
| PubChem CID | 88745536 |
| Molecular Formula | C4H10ClNO3 |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | ethyl 2-amino-2-hydroxyacetate;hydrochloride |
| SMILES | CCOC(=O)C(N)O.Cl |
| InChI | InChI=1S/C4H9NO3.ClH/c1-2-8-4(7)3(5)6;/h3,6H,2,5H2,1H3;1H |
| InChIKey | KTIIKJCUROOAKJ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-2-hydroxyacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-2-hydroxyacetate;hydrochloride?
The IUPAC name of ethyl 2-amino-2-hydroxyacetate;hydrochloride (CID 88745536) is ethyl 2-amino-2-hydroxyacetate;hydrochloride.
What is the SMILES notation for ethyl 2-amino-2-hydroxyacetate;hydrochloride?
The canonical SMILES for ethyl 2-amino-2-hydroxyacetate;hydrochloride is CCOC(=O)C(N)O.Cl.
What is the InChIKey of ethyl 2-amino-2-hydroxyacetate;hydrochloride?
The InChIKey is KTIIKJCUROOAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.ClH/c1-2-8-4(7)3(5)6;/h3,6H,2,5H2,1H3;1H.
What are the key properties of ethyl 2-amino-2-hydroxyacetate;hydrochloride?
ethyl 2-amino-2-hydroxyacetate;hydrochloride has a molecular weight of 155.58 g/mol, XLogP of -0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-2-hydroxyacetate;hydrochloride is sourced from PubChem (CID 88745536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).