C5H10ClF2NO2 — CID 91928398
ethyl (2R)-2-amino-3,3-difluoropropanoate;hydrochloride (PubChem CID 91928398) has the molecular formula C5H10ClF2NO2 and a molecular weight of 189.59 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3,3-difluoropropanoate;hydrochloride.
| Compound Name | ethyl (2R)-2-amino-3,3-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 91928398 |
| Molecular Formula | C5H10ClF2NO2 |
| Molecular Weight | 189.59 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | ethyl (2R)-2-amino-3,3-difluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)C(F)F.Cl |
| InChI | InChI=1S/C5H9F2NO2.ClH/c1-2-10-5(9)3(8)4(6)7;/h3-4H,2,8H2,1H3;1H/t3-;/m0./s1 |
| InChIKey | PFSGTXDTGVRZIW-DFWYDOINSA-N |
| XLogP | 0.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |