C6H10F3NO3 — CID 118989031
ethyl (2R,3S)-2-amino-4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 118989031) has the molecular formula C6H10F3NO3 and a molecular weight of 201.14 g/mol. Its IUPAC name is ethyl (2R,3S)-2-amino-4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | ethyl (2R,3S)-2-amino-4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 118989031 |
| Molecular Formula | C6H10F3NO3 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | ethyl (2R,3S)-2-amino-4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)[C@H](N)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO3/c1-2-13-5(12)3(10)4(11)6(7,8)9/h3-4,11H,2,10H2,1H3/t3-,4+/m1/s1 |
| InChIKey | AHPCJKVVMOHKAR-DMTCNVIQSA-N |
| XLogP | -0.20 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |