C7H12F3NO3 — CID 150708955
ethyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate (PubChem CID 150708955) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is ethyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate.
| Compound Name | ethyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate |
|---|---|
| PubChem CID | 150708955 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | ethyl (2R,3R)-3-amino-4,4,4-trifluoro-2-methoxybutanoate |
| SMILES | CCOC(=O)[C@H](OC)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3/c1-3-14-6(12)4(13-2)5(11)7(8,9)10/h4-5H,3,11H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | JNLVOUYPKWPCAE-RFZPGFLSSA-N |
| XLogP | 0.45 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |