C12H20F3NO2 — CID 151431520
ethyl (2S,3S)-3-amino-2-cyclohexyl-4,4,4-trifluorobutanoate (PubChem CID 151431520) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl (2S,3S)-3-amino-2-cyclohexyl-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (2S,3S)-3-amino-2-cyclohexyl-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 151431520 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | ethyl (2S,3S)-3-amino-2-cyclohexyl-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)[C@@H](C1CCCCC1)[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c1-2-18-11(17)9(10(16)12(13,14)15)8-6-4-3-5-7-8/h8-10H,2-7,16H2,1H3/t9-,10-/m0/s1 |
| InChIKey | PCPOWIBGTNPWBN-UWVGGRQHSA-N |
| XLogP | 2.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |