About 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate
1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate (PubChem CID 177251631) has the molecular formula C20H33NO4
and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate |
| PubChem CID | 177251631 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate |
| SMILES | CCOC(=O)C(C#N)C(C(=O)OCC(C(C)C)C(C)C)C1CCCC1 |
| InChI | InChI=1S/C20H33NO4/c1-6-24-19(22)16(11-21)18(15-9-7-8-10-15)20(23)25-12-17(13(2)3)14(4)5/h13-18H,6-10,12H2,1-5H3 |
| InChIKey | PPTBISYHKQLYBA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate?
The IUPAC name of 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate (CID 177251631) is 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate?
The canonical SMILES for 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate is CCOC(=O)C(C#N)C(C(=O)OCC(C(C)C)C(C)C)C1CCCC1.
What is the InChIKey of 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate?
The InChIKey is PPTBISYHKQLYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO4/c1-6-24-19(22)16(11-21)18(15-9-7-8-10-15)20(23)25-12-17(13(2)3)14(4)5/h13-18H,6-10,12H2,1-5H3.
What are the key properties of 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate?
1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate has a molecular weight of 351.49 g/mol, XLogP of 3.97, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-(3-methyl-2-propan-2-ylbutyl) 2-cyano-3-cyclopentylbutanedioate is sourced from PubChem (CID 177251631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).