C9H13F3O5 — CID 129383390
diethyl 2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]propanedioate (PubChem CID 129383390) has the molecular formula C9H13F3O5 and a molecular weight of 258.19 g/mol. Its IUPAC name is diethyl 2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]propanedioate.
| Compound Name | diethyl 2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]propanedioate |
|---|---|
| PubChem CID | 129383390 |
| Molecular Formula | C9H13F3O5 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | diethyl 2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O5/c1-3-16-7(14)5(8(15)17-4-2)6(13)9(10,11)12/h5-6,13H,3-4H2,1-2H3/t6-/m1/s1 |
| InChIKey | MJLGCAZDDADWAF-ZCFIWIBFSA-N |
| XLogP | 0.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|