C6H7F3O3S — CID 123697516
ethyl 4,4,4-trifluoro-3-hydroxy-2-sulfanylidenebutanoate (PubChem CID 123697516) has the molecular formula C6H7F3O3S and a molecular weight of 216.18 g/mol. Its IUPAC name is ethyl 4,4,4-trifluoro-3-hydroxy-2-sulfanylidenebutanoate.
| Compound Name | ethyl 4,4,4-trifluoro-3-hydroxy-2-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 123697516 |
| Molecular Formula | C6H7F3O3S |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | ethyl 4,4,4-trifluoro-3-hydroxy-2-sulfanylidenebutanoate |
| SMILES | CCOC(=O)C(=S)C(O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O3S/c1-2-12-5(11)3(13)4(10)6(7,8)9/h4,10H,2H2,1H3 |
| InChIKey | OVWFJLGLZLIECA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|