C7H10F3NO3 — CID 155330526
ethyl 2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetate (PubChem CID 155330526) has the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. Its IUPAC name is ethyl 2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetate.
| Compound Name | ethyl 2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetate |
|---|---|
| PubChem CID | 155330526 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | ethyl 2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetate |
| SMILES | CCOC(=O)C(=O)NC(C)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO3/c1-3-14-6(13)5(12)11-4(2)7(8,9)10/h4H,3H2,1-2H3,(H,11,12) |
| InChIKey | UBQIZJXXGXPEOW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|