C6H8F3NO3 — CID 175476798
ethyl 2-oxo-2-(1,2,2-trifluoroethylamino)acetate (PubChem CID 175476798) has the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. Its IUPAC name is ethyl 2-oxo-2-(1,2,2-trifluoroethylamino)acetate.
| Compound Name | ethyl 2-oxo-2-(1,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 175476798 |
| Molecular Formula | C6H8F3NO3 |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | ethyl 2-oxo-2-(1,2,2-trifluoroethylamino)acetate |
| SMILES | CCOC(=O)C(=O)NC(F)C(F)F |
| InChI | InChI=1S/C6H8F3NO3/c1-2-13-6(12)5(11)10-4(9)3(7)8/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | OYTCTUHKOZWIKZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|