C7H9F4NO3 — CID 106295297
ethyl 2-oxo-2-(2,2,3,3-tetrafluoropropylamino)acetate (PubChem CID 106295297) has the molecular formula C7H9F4NO3 and a molecular weight of 231.14 g/mol. Its IUPAC name is ethyl 2-oxo-2-(2,2,3,3-tetrafluoropropylamino)acetate.
| Compound Name | ethyl 2-oxo-2-(2,2,3,3-tetrafluoropropylamino)acetate |
|---|---|
| PubChem CID | 106295297 |
| Molecular Formula | C7H9F4NO3 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | ethyl 2-oxo-2-(2,2,3,3-tetrafluoropropylamino)acetate |
| SMILES | CCOC(=O)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4NO3/c1-2-15-5(14)4(13)12-3-7(10,11)6(8)9/h6H,2-3H2,1H3,(H,12,13) |
| InChIKey | HEQZPHYPDZVIQG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|