C7H12F4N2O2 — CID 106291651
3-amino-2-methoxy-N-(2,2,3,3-tetrafluoropropyl)propanamide (PubChem CID 106291651) has the molecular formula C7H12F4N2O2 and a molecular weight of 232.18 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-(2,2,3,3-tetrafluoropropyl)propanamide.
| Compound Name | 3-amino-2-methoxy-N-(2,2,3,3-tetrafluoropropyl)propanamide |
|---|---|
| PubChem CID | 106291651 |
| Molecular Formula | C7H12F4N2O2 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-amino-2-methoxy-N-(2,2,3,3-tetrafluoropropyl)propanamide |
| SMILES | COC(CN)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H12F4N2O2/c1-15-4(2-12)5(14)13-3-7(10,11)6(8)9/h4,6H,2-3,12H2,1H3,(H,13,14) |
| InChIKey | HHHSTTIMQJHLMU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|