C7H9F4NO3 — CID 106295621
2-methyl-3-oxo-3-(2,2,3,3-tetrafluoropropylamino)propanoic acid (PubChem CID 106295621) has the molecular formula C7H9F4NO3 and a molecular weight of 231.14 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,2,3,3-tetrafluoropropylamino)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(2,2,3,3-tetrafluoropropylamino)propanoic acid |
|---|---|
| PubChem CID | 106295621 |
| Molecular Formula | C7H9F4NO3 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-methyl-3-oxo-3-(2,2,3,3-tetrafluoropropylamino)propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H9F4NO3/c1-3(5(14)15)4(13)12-2-7(10,11)6(8)9/h3,6H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | MFADZFYWDZFEGD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|