C8H10F5NO3 — CID 21072497
2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid (PubChem CID 21072497) has the molecular formula C8H10F5NO3 and a molecular weight of 263.16 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
|---|---|
| PubChem CID | 21072497 |
| Molecular Formula | C8H10F5NO3 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-methyl-3-oxo-3-(3,3,4,4,4-pentafluorobutylamino)propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO3/c1-4(6(16)17)5(15)14-3-2-7(9,10)8(11,12)13/h4H,2-3H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | IJQUDXXQPAHYJE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|