C8H11F5N2O3 — CID 143546222
2-hydroxy-2-methyl-N'-(3,3,4,4,4-pentafluorobutyl)propanediamide (PubChem CID 143546222) has the molecular formula C8H11F5N2O3 and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N'-(3,3,4,4,4-pentafluorobutyl)propanediamide.
| Compound Name | 2-hydroxy-2-methyl-N'-(3,3,4,4,4-pentafluorobutyl)propanediamide |
|---|---|
| PubChem CID | 143546222 |
| Molecular Formula | C8H11F5N2O3 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-hydroxy-2-methyl-N'-(3,3,4,4,4-pentafluorobutyl)propanediamide |
| SMILES | CC(O)(C(N)=O)C(=O)NCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5N2O3/c1-6(18,4(14)16)5(17)15-3-2-7(9,10)8(11,12)13/h18H,2-3H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | XOEVWFMTJBEILO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|