C9H12F5NO4 — CID 86605288
ethyl 2-hydroxy-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoate (PubChem CID 86605288) has the molecular formula C9H12F5NO4 and a molecular weight of 293.19 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoate.
| Compound Name | ethyl 2-hydroxy-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoate |
|---|---|
| PubChem CID | 86605288 |
| Molecular Formula | C9H12F5NO4 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | ethyl 2-hydroxy-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)propanoate |
| SMILES | CCOC(=O)C(C)(O)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5NO4/c1-3-19-6(17)7(2,18)5(16)15-4-8(10,11)9(12,13)14/h18H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | XYCNOZLRKMEACS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|