C16H18F5NO4 — CID 122367679
ethyl (2S)-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)-2-phenylmethoxypropanoate (PubChem CID 122367679) has the molecular formula C16H18F5NO4 and a molecular weight of 383.31 g/mol. Its IUPAC name is ethyl (2S)-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)-2-phenylmethoxypropanoate.
| Compound Name | ethyl (2S)-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 122367679 |
| Molecular Formula | C16H18F5NO4 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl (2S)-2-methyl-3-oxo-3-(2,2,3,3,3-pentafluoropropylamino)-2-phenylmethoxypropanoate |
| SMILES | CCOC(=O)[C@@](C)(OCc1ccccc1)C(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F5NO4/c1-3-25-13(24)14(2,26-9-11-7-5-4-6-8-11)12(23)22-10-15(17,18)16(19,20)21/h4-8H,3,9-10H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | XIRXLBWBICTPQT-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|