C12H11F6NO2 — CID 3658518
N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)acetamide (PubChem CID 3658518) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)acetamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 3658518 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)acetamide |
| SMILES | CC(=O)NC(OCc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F6NO2/c1-8(20)19-10(11(13,14)15,12(16,17)18)21-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,19,20) |
| InChIKey | UODJBPUSMTVGNA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|