C14H20O3 — CID 14683672
(2S)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid (PubChem CID 14683672) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2S)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid.
| Compound Name | (2S)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 14683672 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2S)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid |
| SMILES | CC(C)(C)[C@](C)(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20O3/c1-13(2,3)14(4,12(15)16)17-10-11-8-6-5-7-9-11/h5-9H,10H2,1-4H3,(H,15,16)/t14-/m1/s1 |
| InChIKey | WONSDIOIYUORQZ-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |