C21H34O3 — CID 150922519
2-tert-butyl-7,7-dimethyl-2-phenylmethoxyoctanoic acid (PubChem CID 150922519) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-tert-butyl-7,7-dimethyl-2-phenylmethoxyoctanoic acid.
| Compound Name | 2-tert-butyl-7,7-dimethyl-2-phenylmethoxyoctanoic acid |
|---|---|
| PubChem CID | 150922519 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 2-tert-butyl-7,7-dimethyl-2-phenylmethoxyoctanoic acid |
| SMILES | CC(C)(C)CCCCC(OCc1ccccc1)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C21H34O3/c1-19(2,3)14-10-11-15-21(18(22)23,20(4,5)6)24-16-17-12-8-7-9-13-17/h7-9,12-13H,10-11,14-16H2,1-6H3,(H,22,23) |
| InChIKey | LEICRFMPNNCECL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|