C28H34O10 — CID 18939208
benzyl 2-[2,7-dimethyl-7-(2-oxo-2-phenylmethoxyacetyl)peroxyoctan-2-yl]peroxy-2-oxoacetate (PubChem CID 18939208) has the molecular formula C28H34O10 and a molecular weight of 530.57 g/mol. Its IUPAC name is benzyl 2-[2,7-dimethyl-7-(2-oxo-2-phenylmethoxyacetyl)peroxyoctan-2-yl]peroxy-2-oxoacetate.
| Compound Name | benzyl 2-[2,7-dimethyl-7-(2-oxo-2-phenylmethoxyacetyl)peroxyoctan-2-yl]peroxy-2-oxoacetate |
|---|---|
| PubChem CID | 18939208 |
| Molecular Formula | C28H34O10 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | benzyl 2-[2,7-dimethyl-7-(2-oxo-2-phenylmethoxyacetyl)peroxyoctan-2-yl]peroxy-2-oxoacetate |
| SMILES | CC(C)(CCCCC(C)(C)OOC(=O)C(=O)OCc1ccccc1)OOC(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H34O10/c1-27(2,37-35-25(31)23(29)33-19-21-13-7-5-8-14-21)17-11-12-18-28(3,4)38-36-26(32)24(30)34-20-22-15-9-6-10-16-22/h5-10,13-16H,11-12,17-20H2,1-4H3 |
| InChIKey | OWUDOFMYMKJAGY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|