C16H17F3O5 — CID 172558844
5-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)pentanoic acid (PubChem CID 172558844) has the molecular formula C16H17F3O5 and a molecular weight of 346.30 g/mol. Its IUPAC name is 5-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)pentanoic acid.
| Compound Name | 5-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 172558844 |
| Molecular Formula | C16H17F3O5 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-(1,3-dioxol-2-yl)-2-phenylmethoxy-2-(trifluoromethyl)pentanoic acid |
| SMILES | O=C(O)C(CCCC1OC=CO1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H17F3O5/c17-16(18,19)15(14(20)21,8-4-7-13-22-9-10-23-13)24-11-12-5-2-1-3-6-12/h1-3,5-6,9-10,13H,4,7-8,11H2,(H,20,21) |
| InChIKey | WLUIKJVQSVRPQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |