C18H24F3NO4 — CID 163376954
2-phenylmethoxy-5-[[(2S)-pyrrolidin-2-yl]methoxy]-2-(trifluoromethyl)pentanoic acid (PubChem CID 163376954) has the molecular formula C18H24F3NO4 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-phenylmethoxy-5-[[(2S)-pyrrolidin-2-yl]methoxy]-2-(trifluoromethyl)pentanoic acid.
| Compound Name | 2-phenylmethoxy-5-[[(2S)-pyrrolidin-2-yl]methoxy]-2-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 163376954 |
| Molecular Formula | C18H24F3NO4 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-phenylmethoxy-5-[[(2S)-pyrrolidin-2-yl]methoxy]-2-(trifluoromethyl)pentanoic acid |
| SMILES | O=C(O)C(CCCOC[C@@H]1CCCN1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO4/c19-18(20,21)17(16(23)24,26-12-14-6-2-1-3-7-14)9-5-11-25-13-15-8-4-10-22-15/h1-3,6-7,15,22H,4-5,8-13H2,(H,23,24)/t15-,17?/m0/s1 |
| InChIKey | ADSVOBINAUPMTB-MYJWUSKBSA-N |
| XLogP | 3.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|