C15H18F3NO4 — CID 69153815
benzyl piperidine-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 69153815) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is benzyl piperidine-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl piperidine-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69153815 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | benzyl piperidine-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCc1ccccc1)C1CCCNC1 |
| InChI | InChI=1S/C13H17NO2.C2HF3O2/c15-13(12-7-4-8-14-9-12)16-10-11-5-2-1-3-6-11;3-2(4,5)1(6)7/h1-3,5-6,12,14H,4,7-10H2;(H,6,7) |
| InChIKey | IUOHBKUKDCYOKZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |