C15H16F3NO4 — CID 146597094
benzyl 1-(2,2,2-trifluoroacetyl)oxypiperidine-4-carboxylate (PubChem CID 146597094) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is benzyl 1-(2,2,2-trifluoroacetyl)oxypiperidine-4-carboxylate.
| Compound Name | benzyl 1-(2,2,2-trifluoroacetyl)oxypiperidine-4-carboxylate |
|---|---|
| PubChem CID | 146597094 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | benzyl 1-(2,2,2-trifluoroacetyl)oxypiperidine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCN(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H16F3NO4/c16-15(17,18)14(21)23-19-8-6-12(7-9-19)13(20)22-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | DBANPPCHKHFNJI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |