C18H21F3N2O5S — CID 68600618
[4-[benzylsulfonyl(prop-2-enyl)carbamoyl]piperidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 68600618) has the molecular formula C18H21F3N2O5S and a molecular weight of 434.44 g/mol. Its IUPAC name is [4-[benzylsulfonyl(prop-2-enyl)carbamoyl]piperidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[benzylsulfonyl(prop-2-enyl)carbamoyl]piperidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68600618 |
| Molecular Formula | C18H21F3N2O5S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [4-[benzylsulfonyl(prop-2-enyl)carbamoyl]piperidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CCN(C(=O)C1CCN(OC(=O)C(F)(F)F)CC1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H21F3N2O5S/c1-2-10-23(29(26,27)13-14-6-4-3-5-7-14)16(24)15-8-11-22(12-9-15)28-17(25)18(19,20)21/h2-7,15H,1,8-13H2 |
| InChIKey | YUXRCSSAEVJESQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|