C21H34N2O3S — CID 55689168
1-benzylsulfonyl-N-ethyl-N-(2-ethylbutyl)piperidine-4-carboxamide (PubChem CID 55689168) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-benzylsulfonyl-N-ethyl-N-(2-ethylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-benzylsulfonyl-N-ethyl-N-(2-ethylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55689168 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-benzylsulfonyl-N-ethyl-N-(2-ethylbutyl)piperidine-4-carboxamide |
| SMILES | CCC(CC)CN(CC)C(=O)C1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H34N2O3S/c1-4-18(5-2)16-22(6-3)21(24)20-12-14-23(15-13-20)27(25,26)17-19-10-8-7-9-11-19/h7-11,18,20H,4-6,12-17H2,1-3H3 |
| InChIKey | MDUKGUJFESXPDE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |