C23H32N3O3S+ — CID 9443239
(2R)-N-benzyl-2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-ethylpropanamide (PubChem CID 9443239) has the molecular formula C23H32N3O3S+ and a molecular weight of 430.59 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-ethylpropanamide.
| Compound Name | (2R)-N-benzyl-2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 9443239 |
| Molecular Formula | C23H32N3O3S+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2R)-N-benzyl-2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)[C@@H](C)[NH+]1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O3S/c1-3-24(18-21-10-6-4-7-11-21)23(27)20(2)25-14-16-26(17-15-25)30(28,29)19-22-12-8-5-9-13-22/h4-13,20H,3,14-19H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | QNDOMVCVIBNMGM-HXUWFJFHSA-O |
| XLogP | 1.15 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |