C18H28N3O2+ — CID 9304860
(3S)-1-[(2S)-1-[benzyl(ethyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide (PubChem CID 9304860) has the molecular formula C18H28N3O2+ and a molecular weight of 318.44 g/mol. Its IUPAC name is (3S)-1-[(2S)-1-[benzyl(ethyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[(2S)-1-[benzyl(ethyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9304860 |
| Molecular Formula | C18H28N3O2+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3S)-1-[(2S)-1-[benzyl(ethyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)[C@H](C)[NH+]1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C18H27N3O2/c1-3-20(12-15-8-5-4-6-9-15)18(23)14(2)21-11-7-10-16(13-21)17(19)22/h4-6,8-9,14,16H,3,7,10-13H2,1-2H3,(H2,19,22)/p+1/t14-,16-/m0/s1 |
| InChIKey | GXSACAGXIBFVFA-HOCLYGCPSA-O |
| XLogP | 0.20 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |