C20H32N3O2+ — CID 9443712
1-[(2S)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9443712) has the molecular formula C20H32N3O2+ and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[(2S)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443712 |
| Molecular Formula | C20H32N3O2+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 1-[(2S)-1-[benzyl(tert-butyl)amino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C(=O)N(Cc1ccccc1)C(C)(C)C)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-15(22-12-10-17(11-13-22)18(21)24)19(25)23(20(2,3)4)14-16-8-6-5-7-9-16/h5-9,15,17H,10-14H2,1-4H3,(H2,21,24)/p+1/t15-/m0/s1 |
| InChIKey | BPVFCEDHVBJAQN-HNNXBMFYSA-O |
| XLogP | 0.98 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |