C21H26N3O2S+ — CID 9443644
1-[(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9443644) has the molecular formula C21H26N3O2S+ and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443644 |
| Molecular Formula | C21H26N3O2S+ |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[(2S)-1-oxo-1-(2-phenylsulfanylanilino)propan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1Sc1ccccc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C21H25N3O2S/c1-15(24-13-11-16(12-14-24)20(22)25)21(26)23-18-9-5-6-10-19(18)27-17-7-3-2-4-8-17/h2-10,15-16H,11-14H2,1H3,(H2,22,25)(H,23,26)/p+1/t15-/m0/s1 |
| InChIKey | QJIGHBQXYZHDNQ-HNNXBMFYSA-O |
| XLogP | 1.95 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |