C17H24N3O3+ — CID 9443708
1-[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9443708) has the molecular formula C17H24N3O3+ and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443708 |
| Molecular Formula | C17H24N3O3+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H23N3O3/c1-11(20-9-7-13(8-10-20)16(18)22)17(23)19-15-6-4-3-5-14(15)12(2)21/h3-6,11,13H,7-10H2,1-2H3,(H2,18,22)(H,19,23)/p+1/t11-/m1/s1 |
| InChIKey | XABUCDRZZWFWRW-LLVKDONJSA-O |
| XLogP | -0.00 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |