C16H22F2N3O3+ — CID 9443694
1-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide (PubChem CID 9443694) has the molecular formula C16H22F2N3O3+ and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9443694 |
| Molecular Formula | C16H22F2N3O3+ |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1OC(F)F)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H21F2N3O3/c1-10(21-8-6-11(7-9-21)14(19)22)15(23)20-12-4-2-3-5-13(12)24-16(17)18/h2-5,10-11,16H,6-9H2,1H3,(H2,19,22)(H,20,23)/p+1/t10-/m0/s1 |
| InChIKey | JNHMQPLTHJOVIY-JTQLQIEISA-O |
| XLogP | 0.40 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |