C16H21F2N3O3 — CID 9443697
1-[(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 9443697) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1-[(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9443697 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[(2R)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1OC(F)F)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H21F2N3O3/c1-10(21-8-6-11(7-9-21)14(19)22)15(23)20-12-4-2-3-5-13(12)24-16(17)18/h2-5,10-11,16H,6-9H2,1H3,(H2,19,22)(H,20,23)/t10-/m1/s1 |
| InChIKey | JNHMQPLTHJOVIY-SNVBAGLBSA-N |
| XLogP | 1.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |